C30H36FN2O3+ — CID 25004179
(R)-cyclohexyl-[5-[[(3R)-3-(4-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol (PubChem CID 25004179) has the molecular formula C30H36FN2O3+ and a molecular weight of 491.63 g/mol. Its IUPAC name is (R)-cyclohexyl-[5-[[(3R)-3-(4-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol.
| Compound Name | (R)-cyclohexyl-[5-[[(3R)-3-(4-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 25004179 |
| Molecular Formula | C30H36FN2O3+ |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (R)-cyclohexyl-[5-[[(3R)-3-(4-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol |
| SMILES | O[C@](c1ccccc1)(c1ncc(C[N+]23CCC(CC2)[C@@H](Oc2ccc(F)cc2)C3)o1)C1CCCCC1 |
| InChI | InChI=1S/C30H36FN2O3/c31-25-11-13-26(14-12-25)35-28-21-33(17-15-22(28)16-18-33)20-27-19-32-29(36-27)30(34,23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1,3-4,7-8,11-14,19,22,24,28,34H,2,5-6,9-10,15-18,20-21H2/q+1/t22?,28-,30-,33?/m0/s1 |
| InChIKey | NDWYFUCHSFHSGW-FYLYVPKNSA-N |
| XLogP | 5.82 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|