C20H25F2NO3S — CID 25005073
2-[4-[(2,5-difluorophenyl)methoxy]butoxy]-5-(2-methylsulfanylethoxy)aniline (PubChem CID 25005073) has the molecular formula C20H25F2NO3S and a molecular weight of 397.49 g/mol. Its IUPAC name is 2-[4-[(2,5-difluorophenyl)methoxy]butoxy]-5-(2-methylsulfanylethoxy)aniline.
| Compound Name | 2-[4-[(2,5-difluorophenyl)methoxy]butoxy]-5-(2-methylsulfanylethoxy)aniline |
|---|---|
| PubChem CID | 25005073 |
| Molecular Formula | C20H25F2NO3S |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-[4-[(2,5-difluorophenyl)methoxy]butoxy]-5-(2-methylsulfanylethoxy)aniline |
| SMILES | CSCCOc1ccc(OCCCCOCc2cc(F)ccc2F)c(N)c1 |
| InChI | InChI=1S/C20H25F2NO3S/c1-27-11-10-25-17-5-7-20(19(23)13-17)26-9-3-2-8-24-14-15-12-16(21)4-6-18(15)22/h4-7,12-13H,2-3,8-11,14,23H2,1H3 |
| InChIKey | HFDXZQKEOXHEHU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|