C16H16F2O2 — CID 58376810
1,4-difluoro-2-[2-(4-methylphenoxy)ethoxymethyl]benzene (PubChem CID 58376810) has the molecular formula C16H16F2O2 and a molecular weight of 278.30 g/mol. Its IUPAC name is 1,4-difluoro-2-[2-(4-methylphenoxy)ethoxymethyl]benzene.
| Compound Name | 1,4-difluoro-2-[2-(4-methylphenoxy)ethoxymethyl]benzene |
|---|---|
| PubChem CID | 58376810 |
| Molecular Formula | C16H16F2O2 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1,4-difluoro-2-[2-(4-methylphenoxy)ethoxymethyl]benzene |
| SMILES | Cc1ccc(OCCOCc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C16H16F2O2/c1-12-2-5-15(6-3-12)20-9-8-19-11-13-10-14(17)4-7-16(13)18/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | HNRMZFNTAGJJEX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|