C14H11BF5O- — CID 113347343
[4-[(2,5-difluorophenyl)methoxy]-2-methylphenyl]-trifluoroboranuide (PubChem CID 113347343) has the molecular formula C14H11BF5O- and a molecular weight of 301.04 g/mol. Its IUPAC name is [4-[(2,5-difluorophenyl)methoxy]-2-methylphenyl]-trifluoroboranuide.
| Compound Name | [4-[(2,5-difluorophenyl)methoxy]-2-methylphenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 113347343 |
| Molecular Formula | C14H11BF5O- |
| Molecular Weight | 301.04 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | [4-[(2,5-difluorophenyl)methoxy]-2-methylphenyl]-trifluoroboranuide |
| SMILES | Cc1cc(OCc2cc(F)ccc2F)ccc1[B-](F)(F)F |
| InChI | InChI=1S/C14H11BF5O/c1-9-6-12(3-4-13(9)15(18,19)20)21-8-10-7-11(16)2-5-14(10)17/h2-7H,8H2,1H3/q-1 |
| InChIKey | MOANYMBIBGXPTK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.04 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|