C23H22N6O — CID 25005572
[4-(2,4-diaminoquinazolin-5-yl)piperazin-1-yl]-naphthalen-2-ylmethanone (PubChem CID 25005572) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is [4-(2,4-diaminoquinazolin-5-yl)piperazin-1-yl]-naphthalen-2-ylmethanone.
| Compound Name | [4-(2,4-diaminoquinazolin-5-yl)piperazin-1-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 25005572 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [4-(2,4-diaminoquinazolin-5-yl)piperazin-1-yl]-naphthalen-2-ylmethanone |
| SMILES | Nc1nc(N)c2c(N3CCN(C(=O)c4ccc5ccccc5c4)CC3)cccc2n1 |
| InChI | InChI=1S/C23H22N6O/c24-21-20-18(26-23(25)27-21)6-3-7-19(20)28-10-12-29(13-11-28)22(30)17-9-8-15-4-1-2-5-16(15)14-17/h1-9,14H,10-13H2,(H4,24,25,26,27) |
| InChIKey | JRBZSISPXRGQPT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |