C16H19N3O2S — CID 25005983
N-tert-butyl-4-(5-cyano-1-methylpyrrol-2-yl)benzenesulfonamide (PubChem CID 25005983) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-tert-butyl-4-(5-cyano-1-methylpyrrol-2-yl)benzenesulfonamide.
| Compound Name | N-tert-butyl-4-(5-cyano-1-methylpyrrol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 25005983 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-tert-butyl-4-(5-cyano-1-methylpyrrol-2-yl)benzenesulfonamide |
| SMILES | Cn1c(C#N)ccc1-c1ccc(S(=O)(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-16(2,3)18-22(20,21)14-8-5-12(6-9-14)15-10-7-13(11-17)19(15)4/h5-10,18H,1-4H3 |
| InChIKey | LHSNXLWVNYSDIL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |