C32H36N2O11 — CID 25008734
(7S)-9-acetyl-6,9,11-trihydroxy-7-[(4R)-5-hydroxy-6-methyl-4-(morpholin-4-ylmethylideneamino)oxan-2-yl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 25008734) has the molecular formula C32H36N2O11 and a molecular weight of 624.64 g/mol. Its IUPAC name is (7S)-9-acetyl-6,9,11-trihydroxy-7-[(4R)-5-hydroxy-6-methyl-4-(morpholin-4-ylmethylideneamino)oxan-2-yl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S)-9-acetyl-6,9,11-trihydroxy-7-[(4R)-5-hydroxy-6-methyl-4-(morpholin-4-ylmethylideneamino)oxan-2-yl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 25008734 |
| Molecular Formula | C32H36N2O11 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | (7S)-9-acetyl-6,9,11-trihydroxy-7-[(4R)-5-hydroxy-6-methyl-4-(morpholin-4-ylmethylideneamino)oxan-2-yl]oxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(C)=O)C[C@@H]3OC1C[C@@H](/N=C/N2CCOCC2)C(O)C(C)O1 |
| InChI | InChI=1S/C32H36N2O11/c1-15-27(36)19(33-14-34-7-9-43-10-8-34)11-22(44-15)45-21-13-32(41,16(2)35)12-18-24(21)31(40)26-25(29(18)38)28(37)17-5-4-6-20(42-3)23(17)30(26)39/h4-6,14-15,19,21-22,27,36,38,40-41H,7-13H2,1-3H3/b33-14+/t15?,19-,21+,22?,27?,32?/m1/s1 |
| InChIKey | ACKVRPZIUZEINJ-GFXDWPKYSA-N |
| XLogP | 1.43 |
| TPSA | 184.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|