C11H13Cl3N2O4 — CID 25008811
ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate;hydrochloride (PubChem CID 25008811) has the molecular formula C11H13Cl3N2O4 and a molecular weight of 343.59 g/mol. Its IUPAC name is ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate;hydrochloride.
| Compound Name | ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate;hydrochloride |
|---|---|
| PubChem CID | 25008811 |
| Molecular Formula | C11H13Cl3N2O4 |
| Molecular Weight | 343.59 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | ethyl 2-[(2,3-dichloro-6-nitrophenyl)methylamino]acetate;hydrochloride |
| SMILES | CCOC(=O)CNCc1c([N+](=O)[O-])ccc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C11H12Cl2N2O4.ClH/c1-2-19-10(16)6-14-5-7-9(15(17)18)4-3-8(12)11(7)13;/h3-4,14H,2,5-6H2,1H3;1H |
| InChIKey | OUUNBAYMSDWITP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|