C13H16Cl2N2O4 — CID 87427825
[(2,3-dichloro-6-nitrophenyl)methylamino] 2,2-dimethylbutanoate (PubChem CID 87427825) has the molecular formula C13H16Cl2N2O4 and a molecular weight of 335.19 g/mol. Its IUPAC name is [(2,3-dichloro-6-nitrophenyl)methylamino] 2,2-dimethylbutanoate.
| Compound Name | [(2,3-dichloro-6-nitrophenyl)methylamino] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 87427825 |
| Molecular Formula | C13H16Cl2N2O4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | [(2,3-dichloro-6-nitrophenyl)methylamino] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)ONCc1c([N+](=O)[O-])ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H16Cl2N2O4/c1-4-13(2,3)12(18)21-16-7-8-10(17(19)20)6-5-9(14)11(8)15/h5-6,16H,4,7H2,1-3H3 |
| InChIKey | WIBIYVADXKHLSY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|