C13H15Cl2NO4 — CID 58488974
methyl 4-(2,3-dichloro-6-nitrophenyl)-2,2-dimethylbutanoate (PubChem CID 58488974) has the molecular formula C13H15Cl2NO4 and a molecular weight of 320.17 g/mol. Its IUPAC name is methyl 4-(2,3-dichloro-6-nitrophenyl)-2,2-dimethylbutanoate.
| Compound Name | methyl 4-(2,3-dichloro-6-nitrophenyl)-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58488974 |
| Molecular Formula | C13H15Cl2NO4 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | methyl 4-(2,3-dichloro-6-nitrophenyl)-2,2-dimethylbutanoate |
| SMILES | COC(=O)C(C)(C)CCc1c([N+](=O)[O-])ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H15Cl2NO4/c1-13(2,12(17)20-3)7-6-8-10(16(18)19)5-4-9(14)11(8)15/h4-5H,6-7H2,1-3H3 |
| InChIKey | YVLTXUVNGNAIJK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|