C11H11Cl2NO4 — CID 177149352
tert-butyl 2,4-dichloro-3-nitrobenzoate (PubChem CID 177149352) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is tert-butyl 2,4-dichloro-3-nitrobenzoate.
| Compound Name | tert-butyl 2,4-dichloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 177149352 |
| Molecular Formula | C11H11Cl2NO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | tert-butyl 2,4-dichloro-3-nitrobenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Cl)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C11H11Cl2NO4/c1-11(2,3)18-10(15)6-4-5-7(12)9(8(6)13)14(16)17/h4-5H,1-3H3 |
| InChIKey | PHISHWCOFYUEBN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|