C18H11BrN2O4S — CID 25009030
3-bromo-4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]benzonitrile (PubChem CID 25009030) has the molecular formula C18H11BrN2O4S and a molecular weight of 431.27 g/mol. Its IUPAC name is 3-bromo-4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]benzonitrile.
| Compound Name | 3-bromo-4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]benzonitrile |
|---|---|
| PubChem CID | 25009030 |
| Molecular Formula | C18H11BrN2O4S |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 429.96 |
| IUPAC Name | 3-bromo-4-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]benzonitrile |
| SMILES | COc1cc(/C=C2\SC(=O)NC2=O)ccc1Oc1ccc(C#N)cc1Br |
| InChI | InChI=1S/C18H11BrN2O4S/c1-24-15-7-10(8-16-17(22)21-18(23)26-16)2-5-14(15)25-13-4-3-11(9-20)6-12(13)19/h2-8H,1H3,(H,21,22,23)/b16-8- |
| InChIKey | QBHKKRFRXYNYNA-PXNMLYILSA-N |
| XLogP | 4.45 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|