C19H23N5O2S — CID 25010078
N-[3-[[3-(1H-indazol-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]methanesulfonamide (PubChem CID 25010078) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[3-[[3-(1H-indazol-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[[3-(1H-indazol-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 25010078 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[3-[[3-(1H-indazol-5-ylamino)pyrrolidin-1-yl]methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(CN2CCC(Nc3ccc4[nH]ncc4c3)C2)c1 |
| InChI | InChI=1S/C19H23N5O2S/c1-27(25,26)23-17-4-2-3-14(9-17)12-24-8-7-18(13-24)21-16-5-6-19-15(10-16)11-20-22-19/h2-6,9-11,18,21,23H,7-8,12-13H2,1H3,(H,20,22) |
| InChIKey | CPVFJCZYQSPUEE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |