C21H29F6N3O5 — CID 25010817
N-[2-[(1-propylpiperidin-4-yl)amino]ethyl]benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 25010817) has the molecular formula C21H29F6N3O5 and a molecular weight of 517.47 g/mol. Its IUPAC name is N-[2-[(1-propylpiperidin-4-yl)amino]ethyl]benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[2-[(1-propylpiperidin-4-yl)amino]ethyl]benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 25010817 |
| Molecular Formula | C21H29F6N3O5 |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[2-[(1-propylpiperidin-4-yl)amino]ethyl]benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCCN1CCC(NCCNC(=O)c2ccccc2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O.2C2HF3O2/c1-2-12-20-13-8-16(9-14-20)18-10-11-19-17(21)15-6-4-3-5-7-15;2*3-2(4,5)1(6)7/h3-7,16,18H,2,8-14H2,1H3,(H,19,21);2*(H,6,7) |
| InChIKey | CUETXGAOZKVPGB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|