C25H28ClF6N3O5 — CID 25010801
N-[2-[(1-benzylpiperidin-4-yl)amino]ethyl]-2-chlorobenzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 25010801) has the molecular formula C25H28ClF6N3O5 and a molecular weight of 599.96 g/mol. Its IUPAC name is N-[2-[(1-benzylpiperidin-4-yl)amino]ethyl]-2-chlorobenzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[2-[(1-benzylpiperidin-4-yl)amino]ethyl]-2-chlorobenzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 25010801 |
| Molecular Formula | C25H28ClF6N3O5 |
| Molecular Weight | 599.96 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | N-[2-[(1-benzylpiperidin-4-yl)amino]ethyl]-2-chlorobenzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NCCNC1CCN(Cc2ccccc2)CC1)c1ccccc1Cl.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26ClN3O.2C2HF3O2/c22-20-9-5-4-8-19(20)21(26)24-13-12-23-18-10-14-25(15-11-18)16-17-6-2-1-3-7-17;2*3-2(4,5)1(6)7/h1-9,18,23H,10-16H2,(H,24,26);2*(H,6,7) |
| InChIKey | KIZIZHJUXGLLTQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.96 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|