C31H28F3N3O4 — CID 25011804
N-(3,4-dimethoxyphenyl)-2-phenyl-N'-pyridin-3-yl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]propanediamide (PubChem CID 25011804) has the molecular formula C31H28F3N3O4 and a molecular weight of 563.58 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-phenyl-N'-pyridin-3-yl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]propanediamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-phenyl-N'-pyridin-3-yl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]propanediamide |
|---|---|
| PubChem CID | 25011804 |
| Molecular Formula | C31H28F3N3O4 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-phenyl-N'-pyridin-3-yl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]propanediamide |
| SMILES | COc1ccc(N(CCc2ccc(C(F)(F)F)cc2)C(=O)C(C(=O)Nc2cccnc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C31H28F3N3O4/c1-40-26-15-14-25(19-27(26)41-2)37(18-16-21-10-12-23(13-11-21)31(32,33)34)30(39)28(22-7-4-3-5-8-22)29(38)36-24-9-6-17-35-20-24/h3-15,17,19-20,28H,16,18H2,1-2H3,(H,36,38) |
| InChIKey | HZQFZOQJTXRJBJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|