C27H25FN2O — CID 25012741
N-[[6-[(dimethylamino)methyl]naphthalen-1-yl]methyl]-4-(3-fluorophenyl)benzamide (PubChem CID 25012741) has the molecular formula C27H25FN2O and a molecular weight of 412.51 g/mol. Its IUPAC name is N-[[6-[(dimethylamino)methyl]naphthalen-1-yl]methyl]-4-(3-fluorophenyl)benzamide.
| Compound Name | N-[[6-[(dimethylamino)methyl]naphthalen-1-yl]methyl]-4-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 25012741 |
| Molecular Formula | C27H25FN2O |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[[6-[(dimethylamino)methyl]naphthalen-1-yl]methyl]-4-(3-fluorophenyl)benzamide |
| SMILES | CN(C)Cc1ccc2c(CNC(=O)c3ccc(-c4cccc(F)c4)cc3)cccc2c1 |
| InChI | InChI=1S/C27H25FN2O/c1-30(2)18-19-9-14-26-23(15-19)6-3-7-24(26)17-29-27(31)21-12-10-20(11-13-21)22-5-4-8-25(28)16-22/h3-16H,17-18H2,1-2H3,(H,29,31) |
| InChIKey | KLXAJVCGYKGFQJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |