C30H29N3O — CID 91415061
4-(4-cyanophenyl)-N-[[6-(diethylaminomethyl)naphthalen-1-yl]methyl]benzamide (PubChem CID 91415061) has the molecular formula C30H29N3O and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N-[[6-(diethylaminomethyl)naphthalen-1-yl]methyl]benzamide.
| Compound Name | 4-(4-cyanophenyl)-N-[[6-(diethylaminomethyl)naphthalen-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91415061 |
| Molecular Formula | C30H29N3O |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 4-(4-cyanophenyl)-N-[[6-(diethylaminomethyl)naphthalen-1-yl]methyl]benzamide |
| SMILES | CCN(CC)Cc1ccc2c(CNC(=O)c3ccc(-c4ccc(C#N)cc4)cc3)cccc2c1 |
| InChI | InChI=1S/C30H29N3O/c1-3-33(4-2)21-23-10-17-29-27(18-23)6-5-7-28(29)20-32-30(34)26-15-13-25(14-16-26)24-11-8-22(19-31)9-12-24/h5-18H,3-4,20-21H2,1-2H3,(H,32,34) |
| InChIKey | UQERJUMPNKCENU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |