C32H56N2O3 — CID 25014971
1-[4-[(2S,3S,10S,13S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl]piperazin-1-yl]nonan-1-one (PubChem CID 25014971) has the molecular formula C32H56N2O3 and a molecular weight of 516.81 g/mol. Its IUPAC name is 1-[4-[(2S,3S,10S,13S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl]piperazin-1-yl]nonan-1-one.
| Compound Name | 1-[4-[(2S,3S,10S,13S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl]piperazin-1-yl]nonan-1-one |
|---|---|
| PubChem CID | 25014971 |
| Molecular Formula | C32H56N2O3 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.43 |
| IUPAC Name | 1-[4-[(2S,3S,10S,13S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl]piperazin-1-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CCN([C@H]2C[C@@]3(C)C(CCC4C3CC[C@@]3(C)C4CC[C@@H]3O)C[C@@H]2O)CC1 |
| InChI | InChI=1S/C32H56N2O3/c1-4-5-6-7-8-9-10-30(37)34-19-17-33(18-20-34)27-22-32(3)23(21-28(27)35)11-12-24-25-13-14-29(36)31(25,2)16-15-26(24)32/h23-29,35-36H,4-22H2,1-3H3/t23?,24?,25?,26?,27-,28-,29-,31-,32-/m0/s1 |
| InChIKey | KTMYRAVLAUDSCC-FYJCOOOVSA-N |
| XLogP | 5.62 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|