C27H49NO2 — CID 44576430
(2S,3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2-(octylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 44576430) has the molecular formula C27H49NO2 and a molecular weight of 419.69 g/mol. Its IUPAC name is (2S,3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2-(octylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (2S,3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2-(octylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 44576430 |
| Molecular Formula | C27H49NO2 |
| Molecular Weight | 419.69 g/mol |
| Exact Mass | 419.38 |
| IUPAC Name | (2S,3S,5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2-(octylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CCCCCCCCN[C@H]1C[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]32)C[C@@H]1O |
| InChI | InChI=1S/C27H49NO2/c1-4-5-6-7-8-9-16-28-23-18-27(3)19(17-24(23)29)10-11-20-21-12-13-25(30)26(21,2)15-14-22(20)27/h19-25,28-30H,4-18H2,1-3H3/t19-,20-,21-,22-,23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | QPVTXWVIGLUEKR-JOXZBDCSSA-N |
| XLogP | 5.68 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|