C20H35NO2 — CID 70592517
(8R,9R,10S,13S,14S)-10,13-dimethyl-3-(methylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-2,17-diol (PubChem CID 70592517) has the molecular formula C20H35NO2 and a molecular weight of 321.50 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-10,13-dimethyl-3-(methylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-2,17-diol.
| Compound Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-3-(methylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-2,17-diol |
|---|---|
| PubChem CID | 70592517 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-3-(methylamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-2,17-diol |
| SMILES | CNC1CC2CC[C@@H]3[C@@H](CC[C@]4(C)C(O)CC[C@@H]34)[C@@]2(C)CC1O |
| InChI | InChI=1S/C20H35NO2/c1-19-9-8-15-13(14(19)6-7-18(19)23)5-4-12-10-16(21-3)17(22)11-20(12,15)2/h12-18,21-23H,4-11H2,1-3H3/t12?,13-,14-,15+,16?,17?,18?,19-,20-/m0/s1 |
| InChIKey | DNFYBMKXTXNZQB-NZQWXWGPSA-N |
| XLogP | 2.95 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |