C14H11FN2O2 — CID 25015016
2-[5-fluoro-6-(methylamino)-3-pyridinyl]-1-benzofuran-5-ol (PubChem CID 25015016) has the molecular formula C14H11FN2O2 and a molecular weight of 258.25 g/mol. Its IUPAC name is 2-[5-fluoro-6-(methylamino)-3-pyridinyl]-1-benzofuran-5-ol.
| Compound Name | 2-[5-fluoro-6-(methylamino)-3-pyridinyl]-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 25015016 |
| Molecular Formula | C14H11FN2O2 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-[5-fluoro-6-(methylamino)-3-pyridinyl]-1-benzofuran-5-ol |
| SMILES | CNc1ncc(-c2cc3cc(O)ccc3o2)cc1F |
| InChI | InChI=1S/C14H11FN2O2/c1-16-14-11(15)5-9(7-17-14)13-6-8-4-10(18)2-3-12(8)19-13/h2-7,18H,1H3,(H,16,17) |
| InChIKey | PQCXZHFSSVHSPI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |