C19H20F3N3O3S — CID 25015090
2-[(2R)-5-[3-(trifluoromethyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-1-yl]-2,3-dihydro-1H-inden-2-yl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 25015090) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-[(2R)-5-[3-(trifluoromethyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-1-yl]-2,3-dihydro-1H-inden-2-yl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[(2R)-5-[3-(trifluoromethyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-1-yl]-2,3-dihydro-1H-inden-2-yl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 25015090 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[(2R)-5-[3-(trifluoromethyl)-6,7-dihydro-4H-pyrano[4,3-c]pyrazol-1-yl]-2,3-dihydro-1H-inden-2-yl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1[C@@H]1Cc2ccc(-n3nc(C(F)(F)F)c4c3CCOC4)cc2C1 |
| InChI | InChI=1S/C19H20F3N3O3S/c20-19(21,22)18-16-11-28-6-4-17(16)25(23-18)14-3-2-12-8-15(10-13(12)9-14)24-5-1-7-29(24,26)27/h2-3,9,15H,1,4-8,10-11H2/t15-/m1/s1 |
| InChIKey | ZFPVXYYRQCYJTE-OAHLLOKOSA-N |
| XLogP | 2.47 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |