About 3-azatetracyclo[6.3.1.16,10.01,5]tridecane
3-azatetracyclo[6.3.1.16,10.01,5]tridecane (PubChem CID 25015532) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 3-azatetracyclo[6.3.1.16,10.01,5]tridecane.
Molecular Properties
| Compound Name | 3-azatetracyclo[6.3.1.16,10.01,5]tridecane |
| PubChem CID | 25015532 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3-azatetracyclo[6.3.1.16,10.01,5]tridecane |
| SMILES | C1C2CC3CC1CC1(CNCC31)C2 |
| InChI | InChI=1S/C12H19N/c1-8-2-10-3-9(1)5-12(4-8)7-13-6-11(10)12/h8-11,13H,1-7H2 |
| InChIKey | RUOQMXLPXAWPBS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-azatetracyclo[6.3.1.16,10.01,5]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azatetracyclo[6.3.1.16,10.01,5]tridecane?
The IUPAC name of 3-azatetracyclo[6.3.1.16,10.01,5]tridecane (CID 25015532) is 3-azatetracyclo[6.3.1.16,10.01,5]tridecane.
What is the SMILES notation for 3-azatetracyclo[6.3.1.16,10.01,5]tridecane?
The canonical SMILES for 3-azatetracyclo[6.3.1.16,10.01,5]tridecane is C1C2CC3CC1CC1(CNCC31)C2.
What is the InChIKey of 3-azatetracyclo[6.3.1.16,10.01,5]tridecane?
The InChIKey is RUOQMXLPXAWPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-8-2-10-3-9(1)5-12(4-8)7-13-6-11(10)12/h8-11,13H,1-7H2.
What are the key properties of 3-azatetracyclo[6.3.1.16,10.01,5]tridecane?
3-azatetracyclo[6.3.1.16,10.01,5]tridecane has a molecular weight of 177.29 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azatetracyclo[6.3.1.16,10.01,5]tridecane is sourced from PubChem (CID 25015532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).