C29H35N3O2 — CID 25015934
1-(benzylamino)-4-(4-tert-butylphenyl)-3-[2-(4-methoxyphenyl)ethyl]imidazolidin-2-one (PubChem CID 25015934) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-(benzylamino)-4-(4-tert-butylphenyl)-3-[2-(4-methoxyphenyl)ethyl]imidazolidin-2-one.
| Compound Name | 1-(benzylamino)-4-(4-tert-butylphenyl)-3-[2-(4-methoxyphenyl)ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 25015934 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 1-(benzylamino)-4-(4-tert-butylphenyl)-3-[2-(4-methoxyphenyl)ethyl]imidazolidin-2-one |
| SMILES | COc1ccc(CCN2C(=O)N(NCc3ccccc3)CC2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H35N3O2/c1-29(2,3)25-14-12-24(13-15-25)27-21-32(30-20-23-8-6-5-7-9-23)28(33)31(27)19-18-22-10-16-26(34-4)17-11-22/h5-17,27,30H,18-21H2,1-4H3 |
| InChIKey | UNENWHKEIQELAJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |