C34H42N4O6S — CID 25016335
N-[15-(butan-2-ylsulfonylcarbamoyl)-19-cyclohexyl-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaen-10-yl]-N',N'-dimethyloxamide (PubChem CID 25016335) has the molecular formula C34H42N4O6S and a molecular weight of 634.80 g/mol. Its IUPAC name is N-[15-(butan-2-ylsulfonylcarbamoyl)-19-cyclohexyl-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaen-10-yl]-N',N'-dimethyloxamide.
| Compound Name | N-[15-(butan-2-ylsulfonylcarbamoyl)-19-cyclohexyl-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaen-10-yl]-N',N'-dimethyloxamide |
|---|---|
| PubChem CID | 25016335 |
| Molecular Formula | C34H42N4O6S |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | N-[15-(butan-2-ylsulfonylcarbamoyl)-19-cyclohexyl-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaen-10-yl]-N',N'-dimethyloxamide |
| SMILES | CCC(C)S(=O)(=O)NC(=O)c1ccc2c(C3CCCCC3)c3n(c2c1)CC1(NC(=O)C(=O)N(C)C)CC1c1cc(OC)ccc1-3 |
| InChI | InChI=1S/C34H42N4O6S/c1-6-20(2)45(42,43)36-31(39)22-12-14-25-28(16-22)38-19-34(35-32(40)33(41)37(3)4)18-27(34)26-17-23(44-5)13-15-24(26)30(38)29(25)21-10-8-7-9-11-21/h12-17,20-21,27H,6-11,18-19H2,1-5H3,(H,35,40)(H,36,39) |
| InChIKey | GVKRCRIQNFWFMX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|