C20H25FO3S — CID 25017345
7-(3-phenylmethoxyphenyl)heptane-1-sulfonyl fluoride (PubChem CID 25017345) has the molecular formula C20H25FO3S and a molecular weight of 364.48 g/mol. Its IUPAC name is 7-(3-phenylmethoxyphenyl)heptane-1-sulfonyl fluoride.
| Compound Name | 7-(3-phenylmethoxyphenyl)heptane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 25017345 |
| Molecular Formula | C20H25FO3S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 7-(3-phenylmethoxyphenyl)heptane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)CCCCCCCc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H25FO3S/c21-25(22,23)15-8-3-1-2-5-10-18-13-9-14-20(16-18)24-17-19-11-6-4-7-12-19/h4,6-7,9,11-14,16H,1-3,5,8,10,15,17H2 |
| InChIKey | CEOCDYLHZFETSF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|