C25H20F3N3O3S — CID 25019064
3,4,5-trifluoro-N-[2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]quinolin-5-yl]benzenesulfonamide (PubChem CID 25019064) has the molecular formula C25H20F3N3O3S and a molecular weight of 499.51 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]quinolin-5-yl]benzenesulfonamide.
| Compound Name | 3,4,5-trifluoro-N-[2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]quinolin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25019064 |
| Molecular Formula | C25H20F3N3O3S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 3,4,5-trifluoro-N-[2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]quinolin-5-yl]benzenesulfonamide |
| SMILES | COc1ccc2c(c1)C(Nc1ccc3c(NS(=O)(=O)c4cc(F)c(F)c(F)c4)cccc3n1)CC2 |
| InChI | InChI=1S/C25H20F3N3O3S/c1-34-15-7-5-14-6-9-22(18(14)11-15)30-24-10-8-17-21(29-24)3-2-4-23(17)31-35(32,33)16-12-19(26)25(28)20(27)13-16/h2-5,7-8,10-13,22,31H,6,9H2,1H3,(H,29,30) |
| InChIKey | USSFQEWJEFBXPS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|