C22H15F3N2O2 — CID 25022636
1-[3-(hydroxymethyl)quinolin-7-yl]-4-[4-(trifluoromethyl)phenyl]pyridin-2-one (PubChem CID 25022636) has the molecular formula C22H15F3N2O2 and a molecular weight of 396.37 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)quinolin-7-yl]-4-[4-(trifluoromethyl)phenyl]pyridin-2-one.
| Compound Name | 1-[3-(hydroxymethyl)quinolin-7-yl]-4-[4-(trifluoromethyl)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 25022636 |
| Molecular Formula | C22H15F3N2O2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-[3-(hydroxymethyl)quinolin-7-yl]-4-[4-(trifluoromethyl)phenyl]pyridin-2-one |
| SMILES | O=c1cc(-c2ccc(C(F)(F)F)cc2)ccn1-c1ccc2cc(CO)cnc2c1 |
| InChI | InChI=1S/C22H15F3N2O2/c23-22(24,25)18-4-1-15(2-5-18)16-7-8-27(21(29)10-16)19-6-3-17-9-14(13-28)12-26-20(17)11-19/h1-12,28H,13H2 |
| InChIKey | CZKAAUBWVDMNQQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |