C32H45NO5Si — CID 25022926
tert-butyl (4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-[(E)-2-methyl-4-oxobut-2-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 25022926) has the molecular formula C32H45NO5Si and a molecular weight of 551.80 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-[(E)-2-methyl-4-oxobut-2-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-[(E)-2-methyl-4-oxobut-2-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 25022926 |
| Molecular Formula | C32H45NO5Si |
| Molecular Weight | 551.80 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | tert-butyl (4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-[(E)-2-methyl-4-oxobut-2-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C(=C\C=O)C[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H45NO5Si/c1-24(20-21-34)22-28-27(33(32(8,9)37-28)29(35)38-30(2,3)4)23-36-39(31(5,6)7,25-16-12-10-13-17-25)26-18-14-11-15-19-26/h10-21,27-28H,22-23H2,1-9H3/b24-20+/t27-,28-/m0/s1 |
| InChIKey | MVIQVLZFYVPKIZ-VDCLYECKSA-N |
| XLogP | 5.84 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.80 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|