C18H16Cl2N2O3 — CID 25023378
N-[3-chloro-2-(4-methoxyphenyl)-4-oxoazetidin-1-yl]-2-(4-chlorophenyl)acetamide (PubChem CID 25023378) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is N-[3-chloro-2-(4-methoxyphenyl)-4-oxoazetidin-1-yl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[3-chloro-2-(4-methoxyphenyl)-4-oxoazetidin-1-yl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 25023378 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-[3-chloro-2-(4-methoxyphenyl)-4-oxoazetidin-1-yl]-2-(4-chlorophenyl)acetamide |
| SMILES | COc1ccc(C2C(Cl)C(=O)N2NC(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-25-14-8-4-12(5-9-14)17-16(20)18(24)22(17)21-15(23)10-11-2-6-13(19)7-3-11/h2-9,16-17H,10H2,1H3,(H,21,23) |
| InChIKey | KNZGVVDLPQWNEX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|