C17H13Cl4N3O4 — CID 10790323
N-[3-chloro-2-(4-methoxyphenyl)-4-oxoazetidin-1-yl]-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide (PubChem CID 10790323) has the molecular formula C17H13Cl4N3O4 and a molecular weight of 465.12 g/mol. Its IUPAC name is N-[3-chloro-2-(4-methoxyphenyl)-4-oxoazetidin-1-yl]-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide.
| Compound Name | N-[3-chloro-2-(4-methoxyphenyl)-4-oxoazetidin-1-yl]-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 10790323 |
| Molecular Formula | C17H13Cl4N3O4 |
| Molecular Weight | 465.12 g/mol |
| Exact Mass | 462.97 |
| IUPAC Name | N-[3-chloro-2-(4-methoxyphenyl)-4-oxoazetidin-1-yl]-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide |
| SMILES | COc1ccc(C2C(Cl)C(=O)N2NC(=O)COc2nc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H13Cl4N3O4/c1-27-9-4-2-8(3-5-9)14-13(20)17(26)24(14)23-12(25)7-28-16-11(19)6-10(18)15(21)22-16/h2-6,13-14H,7H2,1H3,(H,23,25) |
| InChIKey | UPDLBLSYIVTSOU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.12 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|