C21H24N2O5 — CID 98290754
N-[(1S,2R,6R,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(4-methoxyphenoxy)acetamide (PubChem CID 98290754) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[(1S,2R,6R,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[(1S,2R,6R,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 98290754 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[(1S,2R,6R,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-(4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)NN2C(=O)[C@H]3[C@H](C2=O)[C@@H]2CC[C@@H]3C2=C(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-11(2)17-14-8-9-15(17)19-18(14)20(25)23(21(19)26)22-16(24)10-28-13-6-4-12(27-3)5-7-13/h4-7,14-15,18-19H,8-10H2,1-3H3,(H,22,24)/t14-,15-,18-,19-/m1/s1 |
| InChIKey | KSFPAYZGMIBWES-OHDICMOHSA-N |
| XLogP | 2.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|