C23H28N2O4 — CID 98289460
(2R)-2-(3,4-dimethylphenoxy)-N-[(1S,2S,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide (PubChem CID 98289460) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethylphenoxy)-N-[(1S,2S,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide.
| Compound Name | (2R)-2-(3,4-dimethylphenoxy)-N-[(1S,2S,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide |
|---|---|
| PubChem CID | 98289460 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2R)-2-(3,4-dimethylphenoxy)-N-[(1S,2S,6S,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanamide |
| SMILES | CC(C)=C1[C@H]2CC[C@H]1[C@@H]1C(=O)N(NC(=O)[C@@H](C)Oc3ccc(C)c(C)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C23H28N2O4/c1-11(2)18-16-8-9-17(18)20-19(16)22(27)25(23(20)28)24-21(26)14(5)29-15-7-6-12(3)13(4)10-15/h6-7,10,14,16-17,19-20H,8-9H2,1-5H3,(H,24,26)/t14-,16-,17-,19+,20+/m1/s1 |
| InChIKey | OEQFDMJKQNXHFA-NQAGYIRISA-N |
| XLogP | 3.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|