C19H22N2O5 — CID 27519450
(2R)-N-[(3aR,4S,7R,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-2-(3,4-dimethylphenoxy)propanamide (PubChem CID 27519450) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2R)-N-[(3aR,4S,7R,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-2-(3,4-dimethylphenoxy)propanamide.
| Compound Name | (2R)-N-[(3aR,4S,7R,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-2-(3,4-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 27519450 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2R)-N-[(3aR,4S,7R,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-2-(3,4-dimethylphenoxy)propanamide |
| SMILES | Cc1ccc(O[C@H](C)C(=O)NN2C(=O)[C@@H]3[C@@H](C2=O)[C@H]2CC[C@@H]3O2)cc1C |
| InChI | InChI=1S/C19H22N2O5/c1-9-4-5-12(8-10(9)2)25-11(3)17(22)20-21-18(23)15-13-6-7-14(26-13)16(15)19(21)24/h4-5,8,11,13-16H,6-7H2,1-3H3,(H,20,22)/t11-,13-,14+,15+,16+/m1/s1 |
| InChIKey | OYSONYPLTCCTHY-VMMWWAARSA-N |
| XLogP | 1.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|