About 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide
2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide (PubChem CID 11668575) has the molecular formula C15H12Cl3N3O4
and a molecular weight of 404.64 g/mol. Its IUPAC name is 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide.
Molecular Properties
| Compound Name | 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide |
| PubChem CID | 11668575 |
| Molecular Formula | C15H12Cl3N3O4 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide |
| SMILES | COc1ccccc1C(=O)NNC(=O)COc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl3N3O4/c1-24-11-5-3-2-4-8(11)14(23)21-20-12(22)7-25-15-10(17)6-9(16)13(18)19-15/h2-6H,7H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | MQXWRTZOSLSSDC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide?
The IUPAC name of 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide (CID 11668575) is 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide.
What is the SMILES notation for 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide?
The canonical SMILES for 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide is COc1ccccc1C(=O)NNC(=O)COc1nc(Cl)c(Cl)cc1Cl.
What is the InChIKey of 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide?
The InChIKey is MQXWRTZOSLSSDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl3N3O4/c1-24-11-5-3-2-4-8(11)14(23)21-20-12(22)7-25-15-10(17)6-9(16)13(18)19-15/h2-6H,7H2,1H3,(H,20,22)(H,21,23).
What are the key properties of 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide?
2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide has a molecular weight of 404.64 g/mol, XLogP of 2.89, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N'-[2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetyl]benzohydrazide is sourced from PubChem (CID 11668575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).