C17H19N7O3 — CID 25023721
4-[7-(3-aminopropoxy)-1-ethyl-4-(furan-3-yl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 25023721) has the molecular formula C17H19N7O3 and a molecular weight of 369.39 g/mol. Its IUPAC name is 4-[7-(3-aminopropoxy)-1-ethyl-4-(furan-3-yl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[7-(3-aminopropoxy)-1-ethyl-4-(furan-3-yl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 25023721 |
| Molecular Formula | C17H19N7O3 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-[7-(3-aminopropoxy)-1-ethyl-4-(furan-3-yl)imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | CCn1c(-c2nonc2N)nc2c(-c3ccoc3)ncc(OCCCN)c21 |
| InChI | InChI=1S/C17H19N7O3/c1-2-24-15-11(26-6-3-5-18)8-20-12(10-4-7-25-9-10)13(15)21-17(24)14-16(19)23-27-22-14/h4,7-9H,2-3,5-6,18H2,1H3,(H2,19,23) |
| InChIKey | SXRCGQAHDJRHJC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|