C17H11ClN4O2S2 — CID 25023759
4-(6-chloroimidazo[1,2-a]pyridin-3-yl)-2-(2-methyl-5-nitrophenyl)sulfanyl-1,3-thiazole (PubChem CID 25023759) has the molecular formula C17H11ClN4O2S2 and a molecular weight of 402.89 g/mol. Its IUPAC name is 4-(6-chloroimidazo[1,2-a]pyridin-3-yl)-2-(2-methyl-5-nitrophenyl)sulfanyl-1,3-thiazole.
| Compound Name | 4-(6-chloroimidazo[1,2-a]pyridin-3-yl)-2-(2-methyl-5-nitrophenyl)sulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 25023759 |
| Molecular Formula | C17H11ClN4O2S2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 4-(6-chloroimidazo[1,2-a]pyridin-3-yl)-2-(2-methyl-5-nitrophenyl)sulfanyl-1,3-thiazole |
| SMILES | Cc1ccc([N+](=O)[O-])cc1Sc1nc(-c2cnc3ccc(Cl)cn23)cs1 |
| InChI | InChI=1S/C17H11ClN4O2S2/c1-10-2-4-12(22(23)24)6-15(10)26-17-20-13(9-25-17)14-7-19-16-5-3-11(18)8-21(14)16/h2-9H,1H3 |
| InChIKey | NTCQJMZAACTUGT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|