C17H11ClN4O3S2 — CID 25023760
4-(6-chloroimidazo[1,2-a]pyridin-3-yl)-2-(2-methyl-5-nitrophenyl)sulfinyl-1,3-thiazole (PubChem CID 25023760) has the molecular formula C17H11ClN4O3S2 and a molecular weight of 418.89 g/mol. Its IUPAC name is 4-(6-chloroimidazo[1,2-a]pyridin-3-yl)-2-(2-methyl-5-nitrophenyl)sulfinyl-1,3-thiazole.
| Compound Name | 4-(6-chloroimidazo[1,2-a]pyridin-3-yl)-2-(2-methyl-5-nitrophenyl)sulfinyl-1,3-thiazole |
|---|---|
| PubChem CID | 25023760 |
| Molecular Formula | C17H11ClN4O3S2 |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 4-(6-chloroimidazo[1,2-a]pyridin-3-yl)-2-(2-methyl-5-nitrophenyl)sulfinyl-1,3-thiazole |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)c1nc(-c2cnc3ccc(Cl)cn23)cs1 |
| InChI | InChI=1S/C17H11ClN4O3S2/c1-10-2-4-12(22(23)24)6-15(10)27(25)17-20-13(9-26-17)14-7-19-16-5-3-11(18)8-21(14)16/h2-9H,1H3 |
| InChIKey | ADSDNLVIHODCEH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|