C15H27NO7P2 — CID 25023882
[2-(5-heptoxy-1-methylpyridin-1-ium-3-yl)-1-phosphonoethyl]-hydroxyphosphinate (PubChem CID 25023882) has the molecular formula C15H27NO7P2 and a molecular weight of 395.33 g/mol. Its IUPAC name is [2-(5-heptoxy-1-methylpyridin-1-ium-3-yl)-1-phosphonoethyl]-hydroxyphosphinate.
| Compound Name | [2-(5-heptoxy-1-methylpyridin-1-ium-3-yl)-1-phosphonoethyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 25023882 |
| Molecular Formula | C15H27NO7P2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [2-(5-heptoxy-1-methylpyridin-1-ium-3-yl)-1-phosphonoethyl]-hydroxyphosphinate |
| SMILES | CCCCCCCOc1cc(CC(P(=O)([O-])O)P(=O)(O)O)c[n+](C)c1 |
| InChI | InChI=1S/C15H27NO7P2/c1-3-4-5-6-7-8-23-14-9-13(11-16(2)12-14)10-15(24(17,18)19)25(20,21)22/h9,11-12,15H,3-8,10H2,1-2H3,(H3-,17,18,19,20,21,22) |
| InChIKey | GGWWUDKWRXFYLP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|