C21H18ClN3O — CID 25024712
(5-chloro-1H-indazol-7-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone (PubChem CID 25024712) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is (5-chloro-1H-indazol-7-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone.
| Compound Name | (5-chloro-1H-indazol-7-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone |
|---|---|
| PubChem CID | 25024712 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (5-chloro-1H-indazol-7-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone |
| SMILES | O=C(c1cc(Cl)cc2cn[nH]c12)N1CCC2(C=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C21H18ClN3O/c22-16-11-15-13-23-24-19(15)17(12-16)20(26)25-9-7-21(8-10-25)6-5-14-3-1-2-4-18(14)21/h1-6,11-13H,7-10H2,(H,23,24) |
| InChIKey | PTHATRVENIKYAT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |