About (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone
(3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone (PubChem CID 72903177) has the molecular formula C21H25N3O
and a molecular weight of 335.45 g/mol. Its IUPAC name is (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone.
Molecular Properties
| Compound Name | (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone |
| PubChem CID | 72903177 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone |
| SMILES | CCCn1cc(C(=O)N2CCC3(C=Cc4ccccc43)CC2)c(C)n1 |
| InChI | InChI=1S/C21H25N3O/c1-3-12-24-15-18(16(2)22-24)20(25)23-13-10-21(11-14-23)9-8-17-6-4-5-7-19(17)21/h4-9,15H,3,10-14H2,1-2H3 |
| InChIKey | DOHFTLQNAKZISM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone?
The IUPAC name of (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone (CID 72903177) is (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone.
What is the SMILES notation for (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone?
The canonical SMILES for (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone is CCCn1cc(C(=O)N2CCC3(C=Cc4ccccc43)CC2)c(C)n1.
What is the InChIKey of (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone?
The InChIKey is DOHFTLQNAKZISM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O/c1-3-12-24-15-18(16(2)22-24)20(25)23-13-10-21(11-14-23)9-8-17-6-4-5-7-19(17)21/h4-9,15H,3,10-14H2,1-2H3.
What are the key properties of (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone?
(3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone has a molecular weight of 335.45 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1-propylpyrazol-4-yl)-spiro[indene-1,4'-piperidine]-1'-ylmethanone is sourced from PubChem (CID 72903177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).