C13H9ClF3N3O — CID 25025245
5-chloro-2-imino-1-[(2,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide (PubChem CID 25025245) has the molecular formula C13H9ClF3N3O and a molecular weight of 315.68 g/mol. Its IUPAC name is 5-chloro-2-imino-1-[(2,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-2-imino-1-[(2,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25025245 |
| Molecular Formula | C13H9ClF3N3O |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 5-chloro-2-imino-1-[(2,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide |
| SMILES | [H]/N=c1/c(C(N)=O)cc(Cl)cn1Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H9ClF3N3O/c14-7-2-8(13(19)21)12(18)20(5-7)4-6-1-10(16)11(17)3-9(6)15/h1-3,5,18H,4H2,(H2,19,21)/b18-12- |
| InChIKey | HREJEWYITXDIDF-PDGQHHTCSA-N |
| XLogP | 2.19 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|