C39H43ClN6O2 — CID 25025767
3-[4-chloro-3-[2-[4-[[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]phenyl]ethynyl]phenyl]-1-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 25025767) has the molecular formula C39H43ClN6O2 and a molecular weight of 663.27 g/mol. Its IUPAC name is 3-[4-chloro-3-[2-[4-[[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]phenyl]ethynyl]phenyl]-1-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | 3-[4-chloro-3-[2-[4-[[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]phenyl]ethynyl]phenyl]-1-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 25025767 |
| Molecular Formula | C39H43ClN6O2 |
| Molecular Weight | 663.27 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | 3-[4-chloro-3-[2-[4-[[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]phenyl]ethynyl]phenyl]-1-(3-morpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | NC(=O)N1CCc2c(c(-c3ccc(Cl)c(C#Cc4ccc(CN[C@@H]5CCCc6ccccc65)cc4)c3)nn2CCCN2CCOCC2)C1 |
| InChI | InChI=1S/C39H43ClN6O2/c40-35-16-15-32(38-34-27-45(39(41)47)20-17-37(34)46(43-38)19-4-18-44-21-23-48-24-22-44)25-31(35)14-13-28-9-11-29(12-10-28)26-42-36-8-3-6-30-5-1-2-7-33(30)36/h1-2,5,7,9-12,15-16,25,36,42H,3-4,6,8,17-24,26-27H2,(H2,41,47)/t36-/m1/s1 |
| InChIKey | DCRGTHUSYIFNLO-PSXMRANNSA-N |
| XLogP | 5.93 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.27 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|