C38H44ClN7OS — CID 59780520
3-[4-chloro-3-[2-[4-[[[4-(dimethylamino)phenyl]methylamino]methyl]phenyl]ethynyl]phenyl]-1-(3-thiomorpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 59780520) has the molecular formula C38H44ClN7OS and a molecular weight of 682.34 g/mol. Its IUPAC name is 3-[4-chloro-3-[2-[4-[[[4-(dimethylamino)phenyl]methylamino]methyl]phenyl]ethynyl]phenyl]-1-(3-thiomorpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | 3-[4-chloro-3-[2-[4-[[[4-(dimethylamino)phenyl]methylamino]methyl]phenyl]ethynyl]phenyl]-1-(3-thiomorpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 59780520 |
| Molecular Formula | C38H44ClN7OS |
| Molecular Weight | 682.34 g/mol |
| Exact Mass | 681.30 |
| IUPAC Name | 3-[4-chloro-3-[2-[4-[[[4-(dimethylamino)phenyl]methylamino]methyl]phenyl]ethynyl]phenyl]-1-(3-thiomorpholin-4-ylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | CN(C)c1ccc(CNCc2ccc(C#Cc3cc(-c4nn(CCCN5CCSCC5)c5c4CN(C(N)=O)CC5)ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C38H44ClN7OS/c1-43(2)33-13-9-30(10-14-33)26-41-25-29-6-4-28(5-7-29)8-11-31-24-32(12-15-35(31)39)37-34-27-45(38(40)47)19-16-36(34)46(42-37)18-3-17-44-20-22-48-23-21-44/h4-7,9-10,12-15,24,41H,3,16-23,25-27H2,1-2H3,(H2,40,47) |
| InChIKey | CVXVQCQVFWKIKI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 82.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.34 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|