C19H19NO6 — CID 25026140
2-[[2-(2-acetyl-4,5-dimethylphenoxy)acetyl]amino]-5-hydroxybenzoic acid (PubChem CID 25026140) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-[[2-(2-acetyl-4,5-dimethylphenoxy)acetyl]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[2-(2-acetyl-4,5-dimethylphenoxy)acetyl]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 25026140 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[[2-(2-acetyl-4,5-dimethylphenoxy)acetyl]amino]-5-hydroxybenzoic acid |
| SMILES | CC(=O)c1cc(C)c(C)cc1OCC(=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C19H19NO6/c1-10-6-14(12(3)21)17(7-11(10)2)26-9-18(23)20-16-5-4-13(22)8-15(16)19(24)25/h4-8,22H,9H2,1-3H3,(H,20,23)(H,24,25) |
| InChIKey | VXGYKZMOGHULKK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|