C16H14N2O7 — CID 25026688
methyl 2,3-dihydroxy-4-[(4-nitrophenyl)methylcarbamoyl]benzoate (PubChem CID 25026688) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-4-[(4-nitrophenyl)methylcarbamoyl]benzoate.
| Compound Name | methyl 2,3-dihydroxy-4-[(4-nitrophenyl)methylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 25026688 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl 2,3-dihydroxy-4-[(4-nitrophenyl)methylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NCc2ccc([N+](=O)[O-])cc2)c(O)c1O |
| InChI | InChI=1S/C16H14N2O7/c1-25-16(22)12-7-6-11(13(19)14(12)20)15(21)17-8-9-2-4-10(5-3-9)18(23)24/h2-7,19-20H,8H2,1H3,(H,17,21) |
| InChIKey | XKPSHSIPHVCYKC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|