C23H28N4 — CID 25031243
1-[[4-[[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methyl]phenyl]methyl]benzimidazole (PubChem CID 25031243) has the molecular formula C23H28N4 and a molecular weight of 360.51 g/mol. Its IUPAC name is 1-[[4-[[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methyl]phenyl]methyl]benzimidazole.
| Compound Name | 1-[[4-[[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methyl]phenyl]methyl]benzimidazole |
|---|---|
| PubChem CID | 25031243 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-[[4-[[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methyl]phenyl]methyl]benzimidazole |
| SMILES | c1ccc2c(c1)ncn2Cc1ccc(CN2CC[C@H](N3CCCC3)C2)cc1 |
| InChI | InChI=1S/C23H28N4/c1-2-6-23-22(5-1)24-18-27(23)16-20-9-7-19(8-10-20)15-25-14-11-21(17-25)26-12-3-4-13-26/h1-2,5-10,18,21H,3-4,11-17H2/t21-/m0/s1 |
| InChIKey | WHUBJQAGVDSTNJ-NRFANRHFSA-N |
| XLogP | 3.75 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |