C22H25BrN6O5S2 — CID 25032364
(NE)-N-[[4-[[5-bromo-4-[[(2R)-3-hydroxy-3-methylbutan-2-yl]amino]pyrimidin-2-yl]amino]phenyl]-methyl-λ4-sulfanylidene]-4-nitrobenzenesulfonamide (PubChem CID 25032364) has the molecular formula C22H25BrN6O5S2 and a molecular weight of 597.52 g/mol. Its IUPAC name is (NE)-N-[[4-[[5-bromo-4-[[(2R)-3-hydroxy-3-methylbutan-2-yl]amino]pyrimidin-2-yl]amino]phenyl]-methyl-λ4-sulfanylidene]-4-nitrobenzenesulfonamide.
| Compound Name | (NE)-N-[[4-[[5-bromo-4-[[(2R)-3-hydroxy-3-methylbutan-2-yl]amino]pyrimidin-2-yl]amino]phenyl]-methyl-λ4-sulfanylidene]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 25032364 |
| Molecular Formula | C22H25BrN6O5S2 |
| Molecular Weight | 597.52 g/mol |
| Exact Mass | 596.05 |
| IUPAC Name | (NE)-N-[[4-[[5-bromo-4-[[(2R)-3-hydroxy-3-methylbutan-2-yl]amino]pyrimidin-2-yl]amino]phenyl]-methyl-λ4-sulfanylidene]-4-nitrobenzenesulfonamide |
| SMILES | C[C@@H](Nc1nc(Nc2ccc(/S(C)=N/S(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)ncc1Br)C(C)(C)O |
| InChI | InChI=1S/C22H25BrN6O5S2/c1-14(22(2,3)30)25-20-19(23)13-24-21(27-20)26-15-5-9-17(10-6-15)35(4)28-36(33,34)18-11-7-16(8-12-18)29(31)32/h5-14,30H,1-4H3,(H2,24,25,26,27)/t14-,35?/m1/s1 |
| InChIKey | PDTMKGQKJXJWEC-OAMPWVDCSA-N |
| XLogP | 4.64 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|