C23H24ClFN6O4 — CID 25032456
7-chloro-6-[[[(3S,4S)-1-[2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)ethyl]-4-hydroxypyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 25032456) has the molecular formula C23H24ClFN6O4 and a molecular weight of 502.93 g/mol. Its IUPAC name is 7-chloro-6-[[[(3S,4S)-1-[2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)ethyl]-4-hydroxypyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 7-chloro-6-[[[(3S,4S)-1-[2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)ethyl]-4-hydroxypyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 25032456 |
| Molecular Formula | C23H24ClFN6O4 |
| Molecular Weight | 502.93 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 7-chloro-6-[[[(3S,4S)-1-[2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)ethyl]-4-hydroxypyrrolidin-3-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2cc(Cl)c(CNC[C@H]3CN(CCn4c(=O)ccc5ncc(F)cc54)C[C@H]3O)nc2N1 |
| InChI | InChI=1S/C23H24ClFN6O4/c24-15-6-20-23(29-21(33)12-35-20)28-17(15)9-26-7-13-10-30(11-19(13)32)3-4-31-18-5-14(25)8-27-16(18)1-2-22(31)34/h1-2,5-6,8,13,19,26,32H,3-4,7,9-12H2,(H,28,29,33)/t13-,19+/m0/s1 |
| InChIKey | ILZGGZPERMOQQB-ORAYPTAESA-N |
| XLogP | 1.00 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.93 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |